methyl 2,2-difluoro-2-(3-hydroxypyrrolidin-3-yl)acetate

C7H11F2NO3 — CID 131412933

IUPACmethyl 2,2-difluoro-2-(3-hydroxypyrrolidin-3-yl)acetate
SMILESCOC(=O)C(F)(F)C1(O)CCNC1
InChIInChI=1S/C7H11F2NO3/c1-13-5(11)7(8,9)6(12)2-3-10-4-6/h10,12H,2-4H2,1H3
InChIKeyYFWSJXCZLLFKRO-UHFFFAOYSA-N
MW195.16 g/mol
LogP-0.48
Rot. Bonds2

About methyl 2,2-difluoro-2-(3-hydroxypyrrolidin-3-yl)acetate

methyl 2,2-difluoro-2-(3-hydroxypyrrolidin-3-yl)acetate (PubChem CID 131412933) has the molecular formula C7H11F2NO3 and a molecular weight of 195.16 g/mol. Its IUPAC name is methyl 2,2-difluoro-2-(3-hydroxypyrrolidin-3-yl)acetate.

Molecular Properties

Compound Namemethyl 2,2-difluoro-2-(3-hydroxypyrrolidin-3-yl)acetate
PubChem CID131412933
Molecular FormulaC7H11F2NO3
Molecular Weight195.16 g/mol
Exact Mass195.07
IUPAC Namemethyl 2,2-difluoro-2-(3-hydroxypyrrolidin-3-yl)acetate
SMILESCOC(=O)C(F)(F)C1(O)CCNC1
InChIInChI=1S/C7H11F2NO3/c1-13-5(11)7(8,9)6(12)2-3-10-4-6/h10,12H,2-4H2,1H3
InChIKeyYFWSJXCZLLFKRO-UHFFFAOYSA-N
XLogP-0.48
TPSA58.56 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500195.16
LogP ≤ 5-0.48
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze methyl 2,2-difluoro-2-(3-hydroxypyrrolidin-3-yl)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2,2-difluoro-2-(3-hydroxypyrrolidin-3-yl)acetate?
The IUPAC name of methyl 2,2-difluoro-2-(3-hydroxypyrrolidin-3-yl)acetate (CID 131412933) is methyl 2,2-difluoro-2-(3-hydroxypyrrolidin-3-yl)acetate.
What is the SMILES notation for methyl 2,2-difluoro-2-(3-hydroxypyrrolidin-3-yl)acetate?
The canonical SMILES for methyl 2,2-difluoro-2-(3-hydroxypyrrolidin-3-yl)acetate is COC(=O)C(F)(F)C1(O)CCNC1.
What is the InChIKey of methyl 2,2-difluoro-2-(3-hydroxypyrrolidin-3-yl)acetate?
The InChIKey is YFWSJXCZLLFKRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11F2NO3/c1-13-5(11)7(8,9)6(12)2-3-10-4-6/h10,12H,2-4H2,1H3.
What are the key properties of methyl 2,2-difluoro-2-(3-hydroxypyrrolidin-3-yl)acetate?
methyl 2,2-difluoro-2-(3-hydroxypyrrolidin-3-yl)acetate has a molecular weight of 195.16 g/mol, XLogP of -0.48, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2,2-difluoro-2-(3-hydroxypyrrolidin-3-yl)acetate is sourced from PubChem (CID 131412933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).