C9H9F5N2 — CID 131474367
(1S)-2,2,3,3,3-pentafluoro-1-(6-methyl-2-pyridinyl)propan-1-amine (PubChem CID 131474367) has the molecular formula C9H9F5N2 and a molecular weight of 240.18 g/mol. Its IUPAC name is (1S)-2,2,3,3,3-pentafluoro-1-(6-methyl-2-pyridinyl)propan-1-amine.
| Compound Name | (1S)-2,2,3,3,3-pentafluoro-1-(6-methyl-2-pyridinyl)propan-1-amine |
|---|---|
| PubChem CID | 131474367 |
| Molecular Formula | C9H9F5N2 |
| Molecular Weight | 240.18 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | (1S)-2,2,3,3,3-pentafluoro-1-(6-methyl-2-pyridinyl)propan-1-amine |
| SMILES | Cc1cccc([C@H](N)C(F)(F)C(F)(F)F)n1 |
| InChI | InChI=1S/C9H9F5N2/c1-5-3-2-4-6(16-5)7(15)8(10,11)9(12,13)14/h2-4,7H,15H2,1H3/t7-/m0/s1 |
| InChIKey | DNLXGRBHMDIFJD-ZETCQYMHSA-N |
| XLogP | 2.59 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.18 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|