C12H20ClN5S — CID 13151100
6-chloro-5-methylsulfanyl-2-piperazin-1-yl-N-propan-2-ylpyrimidin-4-amine (PubChem CID 13151100) has the molecular formula C12H20ClN5S and a molecular weight of 301.85 g/mol. Its IUPAC name is 6-chloro-5-methylsulfanyl-2-piperazin-1-yl-N-propan-2-ylpyrimidin-4-amine.
| Compound Name | 6-chloro-5-methylsulfanyl-2-piperazin-1-yl-N-propan-2-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 13151100 |
| Molecular Formula | C12H20ClN5S |
| Molecular Weight | 301.85 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | 6-chloro-5-methylsulfanyl-2-piperazin-1-yl-N-propan-2-ylpyrimidin-4-amine |
| SMILES | CSc1c(Cl)nc(N2CCNCC2)nc1NC(C)C |
| InChI | InChI=1S/C12H20ClN5S/c1-8(2)15-11-9(19-3)10(13)16-12(17-11)18-6-4-14-5-7-18/h8,14H,4-7H2,1-3H3,(H,15,16,17) |
| InChIKey | DQVPSULWVNBIMG-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.85 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |