C16H28ClN5S — CID 3042442
4-chloro-N-hexyl-6-(4-methylpiperazin-1-yl)-5-methylsulfanylpyrimidin-2-amine (PubChem CID 3042442) has the molecular formula C16H28ClN5S and a molecular weight of 357.96 g/mol. Its IUPAC name is 4-chloro-N-hexyl-6-(4-methylpiperazin-1-yl)-5-methylsulfanylpyrimidin-2-amine.
| Compound Name | 4-chloro-N-hexyl-6-(4-methylpiperazin-1-yl)-5-methylsulfanylpyrimidin-2-amine |
|---|---|
| PubChem CID | 3042442 |
| Molecular Formula | C16H28ClN5S |
| Molecular Weight | 357.96 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | 4-chloro-N-hexyl-6-(4-methylpiperazin-1-yl)-5-methylsulfanylpyrimidin-2-amine |
| SMILES | CCCCCCNc1nc(Cl)c(SC)c(N2CCN(C)CC2)n1 |
| InChI | InChI=1S/C16H28ClN5S/c1-4-5-6-7-8-18-16-19-14(17)13(23-3)15(20-16)22-11-9-21(2)10-12-22/h4-12H2,1-3H3,(H,18,19,20) |
| InChIKey | CXYLMTHFPIHKDD-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.96 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|