C14H24ClN5S — CID 3042447
N-butyl-4-chloro-6-(4-methylpiperazin-1-yl)-5-methylsulfanylpyrimidin-2-amine (PubChem CID 3042447) has the molecular formula C14H24ClN5S and a molecular weight of 329.90 g/mol. Its IUPAC name is N-butyl-4-chloro-6-(4-methylpiperazin-1-yl)-5-methylsulfanylpyrimidin-2-amine.
| Compound Name | N-butyl-4-chloro-6-(4-methylpiperazin-1-yl)-5-methylsulfanylpyrimidin-2-amine |
|---|---|
| PubChem CID | 3042447 |
| Molecular Formula | C14H24ClN5S |
| Molecular Weight | 329.90 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | N-butyl-4-chloro-6-(4-methylpiperazin-1-yl)-5-methylsulfanylpyrimidin-2-amine |
| SMILES | CCCCNc1nc(Cl)c(SC)c(N2CCN(C)CC2)n1 |
| InChI | InChI=1S/C14H24ClN5S/c1-4-5-6-16-14-17-12(15)11(21-3)13(18-14)20-9-7-19(2)8-10-20/h4-10H2,1-3H3,(H,16,17,18) |
| InChIKey | XDWLWCIDJXYZEU-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.90 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|