C10H11N3OS — CID 131519657
3-[(4-methylphenoxy)methyl]-1,2,4-thiadiazol-5-amine (PubChem CID 131519657) has the molecular formula C10H11N3OS and a molecular weight of 221.28 g/mol. Its IUPAC name is 3-[(4-methylphenoxy)methyl]-1,2,4-thiadiazol-5-amine.
| Compound Name | 3-[(4-methylphenoxy)methyl]-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 131519657 |
| Molecular Formula | C10H11N3OS |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.06 |
| IUPAC Name | 3-[(4-methylphenoxy)methyl]-1,2,4-thiadiazol-5-amine |
| SMILES | Cc1ccc(OCc2nsc(N)n2)cc1 |
| InChI | InChI=1S/C10H11N3OS/c1-7-2-4-8(5-3-7)14-6-9-12-10(11)15-13-9/h2-5H,6H2,1H3,(H2,11,12,13) |
| InChIKey | GJJBPTWAUOWCHJ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |