C6H11N3OS — CID 83874182
3-(propan-2-yloxymethyl)-1,2,4-thiadiazol-5-amine (PubChem CID 83874182) has the molecular formula C6H11N3OS and a molecular weight of 173.24 g/mol. Its IUPAC name is 3-(propan-2-yloxymethyl)-1,2,4-thiadiazol-5-amine.
| Compound Name | 3-(propan-2-yloxymethyl)-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 83874182 |
| Molecular Formula | C6H11N3OS |
| Molecular Weight | 173.24 g/mol |
| Exact Mass | 173.06 |
| IUPAC Name | 3-(propan-2-yloxymethyl)-1,2,4-thiadiazol-5-amine |
| SMILES | CC(C)OCc1nsc(N)n1 |
| InChI | InChI=1S/C6H11N3OS/c1-4(2)10-3-5-8-6(7)11-9-5/h4H,3H2,1-2H3,(H2,7,8,9) |
| InChIKey | BDBWNZURPSHGOZ-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.24 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |