C14H10BrClN2O2S — CID 13154575
6-chloro-3-[(3-nitrophenyl)methyl]-1,3-benzothiazol-3-ium bromide (PubChem CID 13154575) has the molecular formula C14H10BrClN2O2S and a molecular weight of 385.67 g/mol. Its IUPAC name is 6-chloro-3-[(3-nitrophenyl)methyl]-1,3-benzothiazol-3-ium bromide.
| Compound Name | 6-chloro-3-[(3-nitrophenyl)methyl]-1,3-benzothiazol-3-ium bromide |
|---|---|
| PubChem CID | 13154575 |
| Molecular Formula | C14H10BrClN2O2S |
| Molecular Weight | 385.67 g/mol |
| Exact Mass | 383.93 |
| IUPAC Name | 6-chloro-3-[(3-nitrophenyl)methyl]-1,3-benzothiazol-3-ium bromide |
| SMILES | O=[N+]([O-])c1cccc(C[n+]2csc3cc(Cl)ccc32)c1.[Br-] |
| InChI | InChI=1S/C14H10ClN2O2S.BrH/c15-11-4-5-13-14(7-11)20-9-16(13)8-10-2-1-3-12(6-10)17(18)19;/h1-7,9H,8H2;1H/q+1;/p-1 |
| InChIKey | WRHAPCCVEYEKGO-UHFFFAOYSA-M |
| XLogP | 0.80 |
| TPSA | 47.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.67 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|