C18H13BrClNS — CID 13154589
6-chloro-3-(naphthalen-2-ylmethyl)-1,3-benzothiazol-3-ium bromide (PubChem CID 13154589) has the molecular formula C18H13BrClNS and a molecular weight of 390.73 g/mol. Its IUPAC name is 6-chloro-3-(naphthalen-2-ylmethyl)-1,3-benzothiazol-3-ium bromide.
| Compound Name | 6-chloro-3-(naphthalen-2-ylmethyl)-1,3-benzothiazol-3-ium bromide |
|---|---|
| PubChem CID | 13154589 |
| Molecular Formula | C18H13BrClNS |
| Molecular Weight | 390.73 g/mol |
| Exact Mass | 388.96 |
| IUPAC Name | 6-chloro-3-(naphthalen-2-ylmethyl)-1,3-benzothiazol-3-ium bromide |
| SMILES | Clc1ccc2c(c1)sc[n+]2Cc1ccc2ccccc2c1.[Br-] |
| InChI | InChI=1S/C18H13ClNS.BrH/c19-16-7-8-17-18(10-16)21-12-20(17)11-13-5-6-14-3-1-2-4-15(14)9-13;/h1-10,12H,11H2;1H/q+1;/p-1 |
| InChIKey | JVXIFRFWKGJDGG-UHFFFAOYSA-M |
| XLogP | 2.05 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.73 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|