C9H12O — CID 13155382
(1E)-1-(2-ethylcyclopenta-2,4-dien-1-ylidene)ethanol (PubChem CID 13155382) has the molecular formula C9H12O and a molecular weight of 136.19 g/mol. Its IUPAC name is (1E)-1-(2-ethylcyclopenta-2,4-dien-1-ylidene)ethanol.
| Compound Name | (1E)-1-(2-ethylcyclopenta-2,4-dien-1-ylidene)ethanol |
|---|---|
| PubChem CID | 13155382 |
| Molecular Formula | C9H12O |
| Molecular Weight | 136.19 g/mol |
| Exact Mass | 136.09 |
| IUPAC Name | (1E)-1-(2-ethylcyclopenta-2,4-dien-1-ylidene)ethanol |
| SMILES | CCC1=CC=C/C1=C(/C)O |
| InChI | InChI=1S/C9H12O/c1-3-8-5-4-6-9(8)7(2)10/h4-6,10H,3H2,1-2H3/b9-7+ |
| InChIKey | DNHRFDNEBIPIAX-VQHVLOKHSA-N |
| XLogP | 2.72 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.19 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|