C10H8N2O3 — CID 131572455
5-(4-methyl-3-pyridinyl)-1,2-oxazole-4-carboxylic acid (PubChem CID 131572455) has the molecular formula C10H8N2O3 and a molecular weight of 204.19 g/mol. Its IUPAC name is 5-(4-methyl-3-pyridinyl)-1,2-oxazole-4-carboxylic acid.
| Compound Name | 5-(4-methyl-3-pyridinyl)-1,2-oxazole-4-carboxylic acid |
|---|---|
| PubChem CID | 131572455 |
| Molecular Formula | C10H8N2O3 |
| Molecular Weight | 204.19 g/mol |
| Exact Mass | 204.05 |
| IUPAC Name | 5-(4-methyl-3-pyridinyl)-1,2-oxazole-4-carboxylic acid |
| SMILES | Cc1ccncc1-c1oncc1C(=O)O |
| InChI | InChI=1S/C10H8N2O3/c1-6-2-3-11-4-7(6)9-8(10(13)14)5-12-15-9/h2-5H,1H3,(H,13,14) |
| InChIKey | OQTKAYIYKUUVOE-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.19 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |