C11H14N2O2 — CID 131574869
(4S)-4-(4-hydroxy-2,6-dimethylphenyl)imidazolidin-2-one (PubChem CID 131574869) has the molecular formula C11H14N2O2 and a molecular weight of 206.24 g/mol. Its IUPAC name is (4S)-4-(4-hydroxy-2,6-dimethylphenyl)imidazolidin-2-one.
| Compound Name | (4S)-4-(4-hydroxy-2,6-dimethylphenyl)imidazolidin-2-one |
|---|---|
| PubChem CID | 131574869 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | (4S)-4-(4-hydroxy-2,6-dimethylphenyl)imidazolidin-2-one |
| SMILES | Cc1cc(O)cc(C)c1[C@H]1CNC(=O)N1 |
| InChI | InChI=1S/C11H14N2O2/c1-6-3-8(14)4-7(2)10(6)9-5-12-11(15)13-9/h3-4,9,14H,5H2,1-2H3,(H2,12,13,15)/t9-/m1/s1 |
| InChIKey | PYLDRINBZFUWJS-SECBINFHSA-N |
| XLogP | 1.36 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |