C8H9FN2O4 — CID 131617225
2-(5-fluoro-2,4-dioxopyrimidin-1-yl)-2-methylpropanoic acid (PubChem CID 131617225) has the molecular formula C8H9FN2O4 and a molecular weight of 216.17 g/mol. Its IUPAC name is 2-(5-fluoro-2,4-dioxopyrimidin-1-yl)-2-methylpropanoic acid.
| Compound Name | 2-(5-fluoro-2,4-dioxopyrimidin-1-yl)-2-methylpropanoic acid |
|---|---|
| PubChem CID | 131617225 |
| Molecular Formula | C8H9FN2O4 |
| Molecular Weight | 216.17 g/mol |
| Exact Mass | 216.05 |
| IUPAC Name | 2-(5-fluoro-2,4-dioxopyrimidin-1-yl)-2-methylpropanoic acid |
| SMILES | CC(C)(C(=O)O)n1cc(F)c(=O)[nH]c1=O |
| InChI | InChI=1S/C8H9FN2O4/c1-8(2,6(13)14)11-3-4(9)5(12)10-7(11)15/h3H,1-2H3,(H,13,14)(H,10,12,15) |
| InChIKey | NOQULDWANXBOAN-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 92.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.17 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |