C19H20N2O4 — CID 13162294
3-[2-(2-phenyl-1,3-dioxolan-2-yl)benzimidazol-1-yl]propane-1,2-diol (PubChem CID 13162294) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is 3-[2-(2-phenyl-1,3-dioxolan-2-yl)benzimidazol-1-yl]propane-1,2-diol.
| Compound Name | 3-[2-(2-phenyl-1,3-dioxolan-2-yl)benzimidazol-1-yl]propane-1,2-diol |
|---|---|
| PubChem CID | 13162294 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | 3-[2-(2-phenyl-1,3-dioxolan-2-yl)benzimidazol-1-yl]propane-1,2-diol |
| SMILES | OCC(O)Cn1c(C2(c3ccccc3)OCCO2)nc2ccccc21 |
| InChI | InChI=1S/C19H20N2O4/c22-13-15(23)12-21-17-9-5-4-8-16(17)20-18(21)19(24-10-11-25-19)14-6-2-1-3-7-14/h1-9,15,22-23H,10-13H2 |
| InChIKey | YDMRRWSUAQHJKT-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |