C16H13F2NO4S — CID 131632855
methyl 2-(benzenesulfonyl)-3-(3,4-difluoroanilino)prop-2-enoate (PubChem CID 131632855) has the molecular formula C16H13F2NO4S and a molecular weight of 353.35 g/mol. Its IUPAC name is methyl 2-(benzenesulfonyl)-3-(3,4-difluoroanilino)prop-2-enoate.
| Compound Name | methyl 2-(benzenesulfonyl)-3-(3,4-difluoroanilino)prop-2-enoate |
|---|---|
| PubChem CID | 131632855 |
| Molecular Formula | C16H13F2NO4S |
| Molecular Weight | 353.35 g/mol |
| Exact Mass | 353.05 |
| IUPAC Name | methyl 2-(benzenesulfonyl)-3-(3,4-difluoroanilino)prop-2-enoate |
| SMILES | COC(=O)C(=CNc1ccc(F)c(F)c1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C16H13F2NO4S/c1-23-16(20)15(24(21,22)12-5-3-2-4-6-12)10-19-11-7-8-13(17)14(18)9-11/h2-10,19H,1H3 |
| InChIKey | RUSPWVJYPXEISV-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.35 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|