C18H17F2NO4S — CID 75527621
methyl (Z)-3-(3,4-difluoroanilino)-2-(4-ethylphenyl)sulfonylprop-2-enoate (PubChem CID 75527621) has the molecular formula C18H17F2NO4S and a molecular weight of 381.40 g/mol. Its IUPAC name is methyl (Z)-3-(3,4-difluoroanilino)-2-(4-ethylphenyl)sulfonylprop-2-enoate.
| Compound Name | methyl (Z)-3-(3,4-difluoroanilino)-2-(4-ethylphenyl)sulfonylprop-2-enoate |
|---|---|
| PubChem CID | 75527621 |
| Molecular Formula | C18H17F2NO4S |
| Molecular Weight | 381.40 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | methyl (Z)-3-(3,4-difluoroanilino)-2-(4-ethylphenyl)sulfonylprop-2-enoate |
| SMILES | CCc1ccc(S(=O)(=O)/C(=C\Nc2ccc(F)c(F)c2)C(=O)OC)cc1 |
| InChI | InChI=1S/C18H17F2NO4S/c1-3-12-4-7-14(8-5-12)26(23,24)17(18(22)25-2)11-21-13-6-9-15(19)16(20)10-13/h4-11,21H,3H2,1-2H3/b17-11- |
| InChIKey | LDTLVYKPLUEFMV-BOPFTXTBSA-N |
| XLogP | 3.43 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.40 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|