C28H35N3O3 — CID 131636449
(6R)-1-(2,6-dimethyl-4-pyridinyl)-6-methyl-3-[4-methyl-3-(oxan-4-ylmethoxy)phenyl]-5,6,8,9-tetrahydroimidazo[1,5-d][1,4]oxazepine (PubChem CID 131636449) has the molecular formula C28H35N3O3 and a molecular weight of 461.61 g/mol. Its IUPAC name is (6R)-1-(2,6-dimethyl-4-pyridinyl)-6-methyl-3-[4-methyl-3-(oxan-4-ylmethoxy)phenyl]-5,6,8,9-tetrahydroimidazo[1,5-d][1,4]oxazepine.
| Compound Name | (6R)-1-(2,6-dimethyl-4-pyridinyl)-6-methyl-3-[4-methyl-3-(oxan-4-ylmethoxy)phenyl]-5,6,8,9-tetrahydroimidazo[1,5-d][1,4]oxazepine |
|---|---|
| PubChem CID | 131636449 |
| Molecular Formula | C28H35N3O3 |
| Molecular Weight | 461.61 g/mol |
| Exact Mass | 461.27 |
| IUPAC Name | (6R)-1-(2,6-dimethyl-4-pyridinyl)-6-methyl-3-[4-methyl-3-(oxan-4-ylmethoxy)phenyl]-5,6,8,9-tetrahydroimidazo[1,5-d][1,4]oxazepine |
| SMILES | Cc1cc(-c2nc(-c3ccc(C)c(OCC4CCOCC4)c3)n3c2CCO[C@H](C)C3)cc(C)n1 |
| InChI | InChI=1S/C28H35N3O3/c1-18-5-6-23(15-26(18)34-17-22-7-10-32-11-8-22)28-30-27(24-13-19(2)29-20(3)14-24)25-9-12-33-21(4)16-31(25)28/h5-6,13-15,21-22H,7-12,16-17H2,1-4H3/t21-/m1/s1 |
| InChIKey | QXTBXXRRCCBCKS-OAQYLSRUSA-N |
| XLogP | 5.30 |
| TPSA | 58.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.61 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |