C14H14N2OSe — CID 13163757
2-(2-amino-1,3-selenazol-4-yl)-2-methyl-3,4-dihydronaphthalen-1-one (PubChem CID 13163757) has the molecular formula C14H14N2OSe and a molecular weight of 305.24 g/mol. Its IUPAC name is 2-(2-amino-1,3-selenazol-4-yl)-2-methyl-3,4-dihydronaphthalen-1-one.
| Compound Name | 2-(2-amino-1,3-selenazol-4-yl)-2-methyl-3,4-dihydronaphthalen-1-one |
|---|---|
| PubChem CID | 13163757 |
| Molecular Formula | C14H14N2OSe |
| Molecular Weight | 305.24 g/mol |
| Exact Mass | 306.03 |
| IUPAC Name | 2-(2-amino-1,3-selenazol-4-yl)-2-methyl-3,4-dihydronaphthalen-1-one |
| SMILES | CC1(c2c[se]c(N)n2)CCc2ccccc2C1=O |
| InChI | InChI=1S/C14H14N2OSe/c1-14(11-8-18-13(15)16-11)7-6-9-4-2-3-5-10(9)12(14)17/h2-5,8H,6-7H2,1H3,(H2,15,16) |
| InChIKey | NUMJFJFNLGNJAB-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.24 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|