C18H18O — CID 86243907
2-methyl-2-(4-methylphenyl)-3,4-dihydronaphthalen-1-one (PubChem CID 86243907) has the molecular formula C18H18O and a molecular weight of 250.34 g/mol. Its IUPAC name is 2-methyl-2-(4-methylphenyl)-3,4-dihydronaphthalen-1-one.
| Compound Name | 2-methyl-2-(4-methylphenyl)-3,4-dihydronaphthalen-1-one |
|---|---|
| PubChem CID | 86243907 |
| Molecular Formula | C18H18O |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 2-methyl-2-(4-methylphenyl)-3,4-dihydronaphthalen-1-one |
| SMILES | Cc1ccc(C2(C)CCc3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C18H18O/c1-13-7-9-15(10-8-13)18(2)12-11-14-5-3-4-6-16(14)17(18)19/h3-10H,11-12H2,1-2H3 |
| InChIKey | GRAHGKOTQISAIV-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |