C15H21FN4O2 — CID 131639872
4-(5-fluoropyrimidin-2-yl)-8-prop-2-enyl-1,11-dioxa-4,8-diazaspiro[5.6]dodecane (PubChem CID 131639872) has the molecular formula C15H21FN4O2 and a molecular weight of 308.36 g/mol. Its IUPAC name is 4-(5-fluoropyrimidin-2-yl)-8-prop-2-enyl-1,11-dioxa-4,8-diazaspiro[5.6]dodecane.
| Compound Name | 4-(5-fluoropyrimidin-2-yl)-8-prop-2-enyl-1,11-dioxa-4,8-diazaspiro[5.6]dodecane |
|---|---|
| PubChem CID | 131639872 |
| Molecular Formula | C15H21FN4O2 |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | 4-(5-fluoropyrimidin-2-yl)-8-prop-2-enyl-1,11-dioxa-4,8-diazaspiro[5.6]dodecane |
| SMILES | C=CCN1CCOCC2(C1)CN(c1ncc(F)cn1)CCO2 |
| InChI | InChI=1S/C15H21FN4O2/c1-2-3-19-4-6-21-12-15(10-19)11-20(5-7-22-15)14-17-8-13(16)9-18-14/h2,8-9H,1,3-7,10-12H2 |
| InChIKey | FAEGXIDNFHJGHE-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 50.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|