C26H44O4 — CID 13164186
2-hydroxy-7-methyl-4-nonyl-3-octyl-3,4-dihydro-2H-pyrano[3,2-c]pyran-5-one (PubChem CID 13164186) has the molecular formula C26H44O4 and a molecular weight of 420.63 g/mol. Its IUPAC name is 2-hydroxy-7-methyl-4-nonyl-3-octyl-3,4-dihydro-2H-pyrano[3,2-c]pyran-5-one.
| Compound Name | 2-hydroxy-7-methyl-4-nonyl-3-octyl-3,4-dihydro-2H-pyrano[3,2-c]pyran-5-one |
|---|---|
| PubChem CID | 13164186 |
| Molecular Formula | C26H44O4 |
| Molecular Weight | 420.63 g/mol |
| Exact Mass | 420.32 |
| IUPAC Name | 2-hydroxy-7-methyl-4-nonyl-3-octyl-3,4-dihydro-2H-pyrano[3,2-c]pyran-5-one |
| SMILES | CCCCCCCCCC1c2c(cc(C)oc2=O)OC(O)C1CCCCCCCC |
| InChI | InChI=1S/C26H44O4/c1-4-6-8-10-12-14-15-17-21-22(18-16-13-11-9-7-5-2)25(27)30-23-19-20(3)29-26(28)24(21)23/h19,21-22,25,27H,4-18H2,1-3H3 |
| InChIKey | NQBMRJRKXMRRQS-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.63 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|