C17H22FNO4S — CID 131643216
4-(4-fluorophenyl)sulfonyl-7-(prop-2-enoxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine (PubChem CID 131643216) has the molecular formula C17H22FNO4S and a molecular weight of 355.43 g/mol. Its IUPAC name is 4-(4-fluorophenyl)sulfonyl-7-(prop-2-enoxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine.
| Compound Name | 4-(4-fluorophenyl)sulfonyl-7-(prop-2-enoxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine |
|---|---|
| PubChem CID | 131643216 |
| Molecular Formula | C17H22FNO4S |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | 4-(4-fluorophenyl)sulfonyl-7-(prop-2-enoxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine |
| SMILES | C=CCOCC1CCC2C1OCCN2S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H22FNO4S/c1-2-10-22-12-13-3-8-16-17(13)23-11-9-19(16)24(20,21)15-6-4-14(18)5-7-15/h2,4-7,13,16-17H,1,3,8-12H2 |
| InChIKey | QKTRZPFMPHOOOW-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|