C14H17FN2O4S — CID 131649540
3-(3-fluorophenyl)sulfonyl-N-methyl-8-oxa-3-azabicyclo[3.2.1]octane-6-carboxamide (PubChem CID 131649540) has the molecular formula C14H17FN2O4S and a molecular weight of 328.37 g/mol. Its IUPAC name is 3-(3-fluorophenyl)sulfonyl-N-methyl-8-oxa-3-azabicyclo[3.2.1]octane-6-carboxamide.
| Compound Name | 3-(3-fluorophenyl)sulfonyl-N-methyl-8-oxa-3-azabicyclo[3.2.1]octane-6-carboxamide |
|---|---|
| PubChem CID | 131649540 |
| Molecular Formula | C14H17FN2O4S |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | 3-(3-fluorophenyl)sulfonyl-N-methyl-8-oxa-3-azabicyclo[3.2.1]octane-6-carboxamide |
| SMILES | CNC(=O)C1CC2CN(S(=O)(=O)c3cccc(F)c3)CC1O2 |
| InChI | InChI=1S/C14H17FN2O4S/c1-16-14(18)12-6-10-7-17(8-13(12)21-10)22(19,20)11-4-2-3-9(15)5-11/h2-5,10,12-13H,6-8H2,1H3,(H,16,18) |
| InChIKey | DLPPFNFYEFOXBD-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |