C15H19FN2O4S — CID 97486958
2-[(2S,3aS,6aS)-5-(3-fluorophenyl)sulfonyl-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-2-yl]-N-methylacetamide (PubChem CID 97486958) has the molecular formula C15H19FN2O4S and a molecular weight of 342.39 g/mol. Its IUPAC name is 2-[(2S,3aS,6aS)-5-(3-fluorophenyl)sulfonyl-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-2-yl]-N-methylacetamide.
| Compound Name | 2-[(2S,3aS,6aS)-5-(3-fluorophenyl)sulfonyl-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-2-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 97486958 |
| Molecular Formula | C15H19FN2O4S |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | 2-[(2S,3aS,6aS)-5-(3-fluorophenyl)sulfonyl-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-2-yl]-N-methylacetamide |
| SMILES | CNC(=O)C[C@@H]1C[C@H]2CN(S(=O)(=O)c3cccc(F)c3)C[C@H]2O1 |
| InChI | InChI=1S/C15H19FN2O4S/c1-17-15(19)7-12-5-10-8-18(9-14(10)22-12)23(20,21)13-4-2-3-11(16)6-13/h2-4,6,10,12,14H,5,7-9H2,1H3,(H,17,19)/t10-,12-,14+/m0/s1 |
| InChIKey | BQRDYHIGXCDLKC-VHRBIJSZSA-N |
| XLogP | 0.74 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |