C16H26N2O4 — CID 131655848
oxolan-3-yl-(8-prop-2-enyl-1,11-dioxa-4,8-diazaspiro[5.6]dodecan-4-yl)methanone (PubChem CID 131655848) has the molecular formula C16H26N2O4 and a molecular weight of 310.39 g/mol. Its IUPAC name is oxolan-3-yl-(8-prop-2-enyl-1,11-dioxa-4,8-diazaspiro[5.6]dodecan-4-yl)methanone.
| Compound Name | oxolan-3-yl-(8-prop-2-enyl-1,11-dioxa-4,8-diazaspiro[5.6]dodecan-4-yl)methanone |
|---|---|
| PubChem CID | 131655848 |
| Molecular Formula | C16H26N2O4 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | oxolan-3-yl-(8-prop-2-enyl-1,11-dioxa-4,8-diazaspiro[5.6]dodecan-4-yl)methanone |
| SMILES | C=CCN1CCOCC2(C1)CN(C(=O)C1CCOC1)CCO2 |
| InChI | InChI=1S/C16H26N2O4/c1-2-4-17-5-8-21-13-16(11-17)12-18(6-9-22-16)15(19)14-3-7-20-10-14/h2,14H,1,3-13H2 |
| InChIKey | UHVUQPKSNCPJRX-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|