C15H24N2O3 — CID 155876988
cyclopropyl-(8-prop-2-enyl-1,11-dioxa-4,8-diazaspiro[5.6]dodecan-4-yl)methanone (PubChem CID 155876988) has the molecular formula C15H24N2O3 and a molecular weight of 280.37 g/mol. Its IUPAC name is cyclopropyl-(8-prop-2-enyl-1,11-dioxa-4,8-diazaspiro[5.6]dodecan-4-yl)methanone.
| Compound Name | cyclopropyl-(8-prop-2-enyl-1,11-dioxa-4,8-diazaspiro[5.6]dodecan-4-yl)methanone |
|---|---|
| PubChem CID | 155876988 |
| Molecular Formula | C15H24N2O3 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | cyclopropyl-(8-prop-2-enyl-1,11-dioxa-4,8-diazaspiro[5.6]dodecan-4-yl)methanone |
| SMILES | C=CCN1CCOCC2(C1)CN(C(=O)C1CC1)CCO2 |
| InChI | InChI=1S/C15H24N2O3/c1-2-5-16-6-8-19-12-15(10-16)11-17(7-9-20-15)14(18)13-3-4-13/h2,13H,1,3-12H2 |
| InChIKey | RZGMUSDGNQRVHI-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|