C18H26N4O3S — CID 131661248
N-[[7-(2-phenylmethoxyethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-5-yl]methyl]ethanesulfonamide (PubChem CID 131661248) has the molecular formula C18H26N4O3S and a molecular weight of 378.50 g/mol. Its IUPAC name is N-[[7-(2-phenylmethoxyethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-5-yl]methyl]ethanesulfonamide.
| Compound Name | N-[[7-(2-phenylmethoxyethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-5-yl]methyl]ethanesulfonamide |
|---|---|
| PubChem CID | 131661248 |
| Molecular Formula | C18H26N4O3S |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | N-[[7-(2-phenylmethoxyethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-5-yl]methyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)NCC1CN(CCOCc2ccccc2)Cc2cncn21 |
| InChI | InChI=1S/C18H26N4O3S/c1-2-26(23,24)20-11-18-13-21(12-17-10-19-15-22(17)18)8-9-25-14-16-6-4-3-5-7-16/h3-7,10,15,18,20H,2,8-9,11-14H2,1H3 |
| InChIKey | BBHCUZWXOICCPJ-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|