C16H22F3N5O5S — CID 155837781
N-[[7-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-5-yl]methyl]methanesulfonamide;2,2,2-trifluoroacetic acid (PubChem CID 155837781) has the molecular formula C16H22F3N5O5S and a molecular weight of 453.44 g/mol. Its IUPAC name is N-[[7-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-5-yl]methyl]methanesulfonamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[[7-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-5-yl]methyl]methanesulfonamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155837781 |
| Molecular Formula | C16H22F3N5O5S |
| Molecular Weight | 453.44 g/mol |
| Exact Mass | 453.13 |
| IUPAC Name | N-[[7-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-5-yl]methyl]methanesulfonamide;2,2,2-trifluoroacetic acid |
| SMILES | Cc1noc(C)c1CN1Cc2cncn2C(CNS(C)(=O)=O)C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H21N5O3S.C2HF3O2/c1-10-14(11(2)22-17-10)8-18-6-12-4-15-9-19(12)13(7-18)5-16-23(3,20)21;3-2(4,5)1(6)7/h4,9,13,16H,5-8H2,1-3H3;(H,6,7) |
| InChIKey | MFLGNLRXZYIYCE-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 130.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.44 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |