C16H25N5O4 — CID 131661616
N-(2-methoxyethyl)-2-(6-methoxypyrimidin-4-yl)-8-methyl-5-oxa-2,8-diazaspiro[3.5]nonane-7-carboxamide (PubChem CID 131661616) has the molecular formula C16H25N5O4 and a molecular weight of 351.41 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2-(6-methoxypyrimidin-4-yl)-8-methyl-5-oxa-2,8-diazaspiro[3.5]nonane-7-carboxamide.
| Compound Name | N-(2-methoxyethyl)-2-(6-methoxypyrimidin-4-yl)-8-methyl-5-oxa-2,8-diazaspiro[3.5]nonane-7-carboxamide |
|---|---|
| PubChem CID | 131661616 |
| Molecular Formula | C16H25N5O4 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | N-(2-methoxyethyl)-2-(6-methoxypyrimidin-4-yl)-8-methyl-5-oxa-2,8-diazaspiro[3.5]nonane-7-carboxamide |
| SMILES | COCCNC(=O)C1COC2(CN(c3cc(OC)ncn3)C2)CN1C |
| InChI | InChI=1S/C16H25N5O4/c1-20-8-16(25-7-12(20)15(22)17-4-5-23-2)9-21(10-16)13-6-14(24-3)19-11-18-13/h6,11-12H,4-5,7-10H2,1-3H3,(H,17,22) |
| InChIKey | PWZZLYHCNMRLJR-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 89.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|