C28H35N3O7 — CID 42821075
8-(3,4-dimethoxybenzoyl)-N-(2-methoxyethyl)-4-(4-methylbenzoyl)-1-oxa-4,8-diazaspiro[4.5]decane-3-carboxamide (PubChem CID 42821075) has the molecular formula C28H35N3O7 and a molecular weight of 525.60 g/mol. Its IUPAC name is 8-(3,4-dimethoxybenzoyl)-N-(2-methoxyethyl)-4-(4-methylbenzoyl)-1-oxa-4,8-diazaspiro[4.5]decane-3-carboxamide.
| Compound Name | 8-(3,4-dimethoxybenzoyl)-N-(2-methoxyethyl)-4-(4-methylbenzoyl)-1-oxa-4,8-diazaspiro[4.5]decane-3-carboxamide |
|---|---|
| PubChem CID | 42821075 |
| Molecular Formula | C28H35N3O7 |
| Molecular Weight | 525.60 g/mol |
| Exact Mass | 525.25 |
| IUPAC Name | 8-(3,4-dimethoxybenzoyl)-N-(2-methoxyethyl)-4-(4-methylbenzoyl)-1-oxa-4,8-diazaspiro[4.5]decane-3-carboxamide |
| SMILES | COCCNC(=O)C1COC2(CCN(C(=O)c3ccc(OC)c(OC)c3)CC2)N1C(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C28H35N3O7/c1-19-5-7-20(8-6-19)27(34)31-22(25(32)29-13-16-35-2)18-38-28(31)11-14-30(15-12-28)26(33)21-9-10-23(36-3)24(17-21)37-4/h5-10,17,22H,11-16,18H2,1-4H3,(H,29,32) |
| InChIKey | XXWIXIQNJKLFAS-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 106.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.60 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|