C25H27ClFN3O5 — CID 93138533
(3S)-8-(2-chlorobenzoyl)-4-(3-fluorobenzoyl)-N-(2-methoxyethyl)-1-oxa-4,8-diazaspiro[4.5]decane-3-carboxamide (PubChem CID 93138533) has the molecular formula C25H27ClFN3O5 and a molecular weight of 503.96 g/mol. Its IUPAC name is (3S)-8-(2-chlorobenzoyl)-4-(3-fluorobenzoyl)-N-(2-methoxyethyl)-1-oxa-4,8-diazaspiro[4.5]decane-3-carboxamide.
| Compound Name | (3S)-8-(2-chlorobenzoyl)-4-(3-fluorobenzoyl)-N-(2-methoxyethyl)-1-oxa-4,8-diazaspiro[4.5]decane-3-carboxamide |
|---|---|
| PubChem CID | 93138533 |
| Molecular Formula | C25H27ClFN3O5 |
| Molecular Weight | 503.96 g/mol |
| Exact Mass | 503.16 |
| IUPAC Name | (3S)-8-(2-chlorobenzoyl)-4-(3-fluorobenzoyl)-N-(2-methoxyethyl)-1-oxa-4,8-diazaspiro[4.5]decane-3-carboxamide |
| SMILES | COCCNC(=O)[C@@H]1COC2(CCN(C(=O)c3ccccc3Cl)CC2)N1C(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C25H27ClFN3O5/c1-34-14-11-28-22(31)21-16-35-25(30(21)23(32)17-5-4-6-18(27)15-17)9-12-29(13-10-25)24(33)19-7-2-3-8-20(19)26/h2-8,15,21H,9-14,16H2,1H3,(H,28,31)/t21-/m0/s1 |
| InChIKey | NULUYKIVQAKSND-NRFANRHFSA-N |
| XLogP | 2.72 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.96 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|