C25H37N3O5 — CID 71955289
8-(3,3-dimethylbutanoyl)-N-(2-methoxyethyl)-4-(3-methylbenzoyl)-1-oxa-4,8-diazaspiro[4.5]decane-3-carboxamide (PubChem CID 71955289) has the molecular formula C25H37N3O5 and a molecular weight of 459.59 g/mol. Its IUPAC name is 8-(3,3-dimethylbutanoyl)-N-(2-methoxyethyl)-4-(3-methylbenzoyl)-1-oxa-4,8-diazaspiro[4.5]decane-3-carboxamide.
| Compound Name | 8-(3,3-dimethylbutanoyl)-N-(2-methoxyethyl)-4-(3-methylbenzoyl)-1-oxa-4,8-diazaspiro[4.5]decane-3-carboxamide |
|---|---|
| PubChem CID | 71955289 |
| Molecular Formula | C25H37N3O5 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.27 |
| IUPAC Name | 8-(3,3-dimethylbutanoyl)-N-(2-methoxyethyl)-4-(3-methylbenzoyl)-1-oxa-4,8-diazaspiro[4.5]decane-3-carboxamide |
| SMILES | COCCNC(=O)C1COC2(CCN(C(=O)CC(C)(C)C)CC2)N1C(=O)c1cccc(C)c1 |
| InChI | InChI=1S/C25H37N3O5/c1-18-7-6-8-19(15-18)23(31)28-20(22(30)26-11-14-32-5)17-33-25(28)9-12-27(13-10-25)21(29)16-24(2,3)4/h6-8,15,20H,9-14,16-17H2,1-5H3,(H,26,30) |
| InChIKey | NSBXEHSWIDUHRX-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|