C17H26N4O4 — CID 97422154
(2R)-N-(2-methoxyethyl)-8-(6-methoxypyrimidin-4-yl)-1-oxa-8-azaspiro[4.5]decane-2-carboxamide (PubChem CID 97422154) has the molecular formula C17H26N4O4 and a molecular weight of 350.42 g/mol. Its IUPAC name is (2R)-N-(2-methoxyethyl)-8-(6-methoxypyrimidin-4-yl)-1-oxa-8-azaspiro[4.5]decane-2-carboxamide.
| Compound Name | (2R)-N-(2-methoxyethyl)-8-(6-methoxypyrimidin-4-yl)-1-oxa-8-azaspiro[4.5]decane-2-carboxamide |
|---|---|
| PubChem CID | 97422154 |
| Molecular Formula | C17H26N4O4 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | (2R)-N-(2-methoxyethyl)-8-(6-methoxypyrimidin-4-yl)-1-oxa-8-azaspiro[4.5]decane-2-carboxamide |
| SMILES | COCCNC(=O)[C@H]1CCC2(CCN(c3cc(OC)ncn3)CC2)O1 |
| InChI | InChI=1S/C17H26N4O4/c1-23-10-7-18-16(22)13-3-4-17(25-13)5-8-21(9-6-17)14-11-15(24-2)20-12-19-14/h11-13H,3-10H2,1-2H3,(H,18,22)/t13-/m1/s1 |
| InChIKey | OVBXEJZQFSSNLQ-CYBMUJFWSA-N |
| XLogP | 0.77 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|