C12H16N2O3S2 — CID 131662162
2-methylsulfonyl-7-pyridin-3-yloxy-5-thia-2-azaspiro[3.4]octane (PubChem CID 131662162) has the molecular formula C12H16N2O3S2 and a molecular weight of 300.40 g/mol. Its IUPAC name is 2-methylsulfonyl-7-pyridin-3-yloxy-5-thia-2-azaspiro[3.4]octane.
| Compound Name | 2-methylsulfonyl-7-pyridin-3-yloxy-5-thia-2-azaspiro[3.4]octane |
|---|---|
| PubChem CID | 131662162 |
| Molecular Formula | C12H16N2O3S2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | 2-methylsulfonyl-7-pyridin-3-yloxy-5-thia-2-azaspiro[3.4]octane |
| SMILES | CS(=O)(=O)N1CC2(CC(Oc3cccnc3)CS2)C1 |
| InChI | InChI=1S/C12H16N2O3S2/c1-19(15,16)14-8-12(9-14)5-11(7-18-12)17-10-3-2-4-13-6-10/h2-4,6,11H,5,7-9H2,1H3 |
| InChIKey | SYLASPMQTDBTTL-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |