C15H16N4OS — CID 133140244
7-pyridin-3-yloxy-2-pyrimidin-2-yl-5-thia-2-azaspiro[3.4]octane (PubChem CID 133140244) has the molecular formula C15H16N4OS and a molecular weight of 300.39 g/mol. Its IUPAC name is 7-pyridin-3-yloxy-2-pyrimidin-2-yl-5-thia-2-azaspiro[3.4]octane.
| Compound Name | 7-pyridin-3-yloxy-2-pyrimidin-2-yl-5-thia-2-azaspiro[3.4]octane |
|---|---|
| PubChem CID | 133140244 |
| Molecular Formula | C15H16N4OS |
| Molecular Weight | 300.39 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 7-pyridin-3-yloxy-2-pyrimidin-2-yl-5-thia-2-azaspiro[3.4]octane |
| SMILES | c1cnc(N2CC3(CC(Oc4cccnc4)CS3)C2)nc1 |
| InChI | InChI=1S/C15H16N4OS/c1-3-12(8-16-4-1)20-13-7-15(21-9-13)10-19(11-15)14-17-5-2-6-18-14/h1-6,8,13H,7,9-11H2 |
| InChIKey | QUHVIOXVRDDNEP-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.39 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |