C6H12ClN3 — CID 131664263
3-chloro-2,3,4,4a,5,6,7,7a-octahydro-1H-pyrrolo[2,3-c]pyridazine (PubChem CID 131664263) has the molecular formula C6H12ClN3 and a molecular weight of 161.64 g/mol. Its IUPAC name is 3-chloro-2,3,4,4a,5,6,7,7a-octahydro-1H-pyrrolo[2,3-c]pyridazine.
| Compound Name | 3-chloro-2,3,4,4a,5,6,7,7a-octahydro-1H-pyrrolo[2,3-c]pyridazine |
|---|---|
| PubChem CID | 131664263 |
| Molecular Formula | C6H12ClN3 |
| Molecular Weight | 161.64 g/mol |
| Exact Mass | 161.07 |
| IUPAC Name | 3-chloro-2,3,4,4a,5,6,7,7a-octahydro-1H-pyrrolo[2,3-c]pyridazine |
| SMILES | ClC1CC2CCNC2NN1 |
| InChI | InChI=1S/C6H12ClN3/c7-5-3-4-1-2-8-6(4)10-9-5/h4-6,8-10H,1-3H2 |
| InChIKey | IUWAOIARLUONFT-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.64 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|