C4H7Cl3N2 — CID 42608862
2,4,6-trichloro-1,3-diazinane (PubChem CID 42608862) has the molecular formula C4H7Cl3N2 and a molecular weight of 189.47 g/mol. Its IUPAC name is 2,4,6-trichloro-1,3-diazinane.
| Compound Name | 2,4,6-trichloro-1,3-diazinane |
|---|---|
| PubChem CID | 42608862 |
| Molecular Formula | C4H7Cl3N2 |
| Molecular Weight | 189.47 g/mol |
| Exact Mass | 187.97 |
| IUPAC Name | 2,4,6-trichloro-1,3-diazinane |
| SMILES | ClC1CC(Cl)NC(Cl)N1 |
| InChI | InChI=1S/C4H7Cl3N2/c5-2-1-3(6)9-4(7)8-2/h2-4,8-9H,1H2 |
| InChIKey | CJESCNFAMHIYSD-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.47 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|