About 6-chloropiperidine-2,3-diamine
6-chloropiperidine-2,3-diamine (PubChem CID 66791814) has the molecular formula C5H12ClN3
and a molecular weight of 149.62 g/mol. Its IUPAC name is 6-chloropiperidine-2,3-diamine.
Molecular Properties
| Compound Name | 6-chloropiperidine-2,3-diamine |
| PubChem CID | 66791814 |
| Molecular Formula | C5H12ClN3 |
| Molecular Weight | 149.62 g/mol |
| Exact Mass | 149.07 |
| IUPAC Name | 6-chloropiperidine-2,3-diamine |
| SMILES | NC1CCC(Cl)NC1N |
| InChI | InChI=1S/C5H12ClN3/c6-4-2-1-3(7)5(8)9-4/h3-5,9H,1-2,7-8H2 |
| InChIKey | HXSDUQAZXJNMFQ-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.62 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 6-chloropiperidine-2,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloropiperidine-2,3-diamine?
The IUPAC name of 6-chloropiperidine-2,3-diamine (CID 66791814) is 6-chloropiperidine-2,3-diamine.
What is the SMILES notation for 6-chloropiperidine-2,3-diamine?
The canonical SMILES for 6-chloropiperidine-2,3-diamine is NC1CCC(Cl)NC1N.
What is the InChIKey of 6-chloropiperidine-2,3-diamine?
The InChIKey is HXSDUQAZXJNMFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12ClN3/c6-4-2-1-3(7)5(8)9-4/h3-5,9H,1-2,7-8H2.
What are the key properties of 6-chloropiperidine-2,3-diamine?
6-chloropiperidine-2,3-diamine has a molecular weight of 149.62 g/mol, XLogP of -0.45, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloropiperidine-2,3-diamine is sourced from PubChem (CID 66791814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).