C6H13ClN2 — CID 159121822
3-chlorocyclohexane-1,2-diamine (PubChem CID 159121822) has the molecular formula C6H13ClN2 and a molecular weight of 148.64 g/mol. Its IUPAC name is 3-chlorocyclohexane-1,2-diamine.
| Compound Name | 3-chlorocyclohexane-1,2-diamine |
|---|---|
| PubChem CID | 159121822 |
| Molecular Formula | C6H13ClN2 |
| Molecular Weight | 148.64 g/mol |
| Exact Mass | 148.08 |
| IUPAC Name | 3-chlorocyclohexane-1,2-diamine |
| SMILES | NC1CCCC(Cl)C1N |
| InChI | InChI=1S/C6H13ClN2/c7-4-2-1-3-5(8)6(4)9/h4-6H,1-3,8-9H2 |
| InChIKey | PUQHVPAHRDQKCE-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.64 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|