C3H6N2 — CID 101033325
2,4-diazabicyclo[1.1.1]pentane (PubChem CID 101033325) has the molecular formula C3H6N2 and a molecular weight of 70.10 g/mol. Its IUPAC name is 2,4-diazabicyclo[1.1.1]pentane.
| Compound Name | 2,4-diazabicyclo[1.1.1]pentane |
|---|---|
| PubChem CID | 101033325 |
| Molecular Formula | C3H6N2 |
| Molecular Weight | 70.10 g/mol |
| Exact Mass | 70.05 |
| IUPAC Name | 2,4-diazabicyclo[1.1.1]pentane |
| SMILES | C1C2NC1N2 |
| InChI | InChI=1S/C3H6N2/c1-2-4-3(1)5-2/h2-5H,1H2 |
| InChIKey | QCQVZCGCTMZGQH-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 70.10 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |