C6H11NO2 — CID 176808697
3-azabicyclo[3.1.1]heptane-2,4-diol (PubChem CID 176808697) has the molecular formula C6H11NO2 and a molecular weight of 129.16 g/mol. Its IUPAC name is 3-azabicyclo[3.1.1]heptane-2,4-diol.
| Compound Name | 3-azabicyclo[3.1.1]heptane-2,4-diol |
|---|---|
| PubChem CID | 176808697 |
| Molecular Formula | C6H11NO2 |
| Molecular Weight | 129.16 g/mol |
| Exact Mass | 129.08 |
| IUPAC Name | 3-azabicyclo[3.1.1]heptane-2,4-diol |
| SMILES | OC1NC(O)C2CC1C2 |
| InChI | InChI=1S/C6H11NO2/c8-5-3-1-4(2-3)6(9)7-5/h3-9H,1-2H2 |
| InChIKey | QBTZKACHYJWUEV-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.16 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |