C28H28ClN3O7 — CID 131664591
5-[[4-[3-(4-methoxy-6-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-5-yl)prop-2-ynoxy]phenyl]methylidene]-1,3-dimethyl-1,3-diazinane-2,4,6-trione;hydrochloride (PubChem CID 131664591) has the molecular formula C28H28ClN3O7 and a molecular weight of 554.00 g/mol. Its IUPAC name is 5-[[4-[3-(4-methoxy-6-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-5-yl)prop-2-ynoxy]phenyl]methylidene]-1,3-dimethyl-1,3-diazinane-2,4,6-trione;hydrochloride.
| Compound Name | 5-[[4-[3-(4-methoxy-6-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-5-yl)prop-2-ynoxy]phenyl]methylidene]-1,3-dimethyl-1,3-diazinane-2,4,6-trione;hydrochloride |
|---|---|
| PubChem CID | 131664591 |
| Molecular Formula | C28H28ClN3O7 |
| Molecular Weight | 554.00 g/mol |
| Exact Mass | 553.16 |
| IUPAC Name | 5-[[4-[3-(4-methoxy-6-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-5-yl)prop-2-ynoxy]phenyl]methylidene]-1,3-dimethyl-1,3-diazinane-2,4,6-trione;hydrochloride |
| SMILES | COc1c2c(cc3c1C(C#CCOc1ccc(C=C4C(=O)N(C)C(=O)N(C)C4=O)cc1)N(C)CC3)OCO2.Cl |
| InChI | InChI=1S/C28H27N3O7.ClH/c1-29-12-11-18-15-22-24(38-16-37-22)25(35-4)23(18)21(29)6-5-13-36-19-9-7-17(8-10-19)14-20-26(32)30(2)28(34)31(3)27(20)33;/h7-10,14-15,21H,11-13,16H2,1-4H3;1H |
| InChIKey | DECUNHCJEOXYCJ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 97.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.00 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|