About 1-ethyl-4-[2-(5-methoxyindol-3-ylidene)ethylidene]quinoline;hydroiodide
1-ethyl-4-[2-(5-methoxyindol-3-ylidene)ethylidene]quinoline;hydroiodide (PubChem CID 131666989) has the molecular formula C22H21IN2O
and a molecular weight of 456.33 g/mol. Its IUPAC name is 1-ethyl-4-[2-(5-methoxyindol-3-ylidene)ethylidene]quinoline;hydroiodide.
Molecular Properties
| Compound Name | 1-ethyl-4-[2-(5-methoxyindol-3-ylidene)ethylidene]quinoline;hydroiodide |
| PubChem CID | 131666989 |
| Molecular Formula | C22H21IN2O |
| Molecular Weight | 456.33 g/mol |
| Exact Mass | 456.07 |
| IUPAC Name | 1-ethyl-4-[2-(5-methoxyindol-3-ylidene)ethylidene]quinoline;hydroiodide |
| SMILES | CCN1C=CC(=CC=C2C=Nc3ccc(OC)cc32)c2ccccc21.I |
| InChI | InChI=1S/C22H20N2O.HI/c1-3-24-13-12-16(19-6-4-5-7-22(19)24)8-9-17-15-23-21-11-10-18(25-2)14-20(17)21;/h4-15H,3H2,1-2H3;1H |
| InChIKey | BWZODQDJTUVIDT-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 456.33 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'dyes7A(2)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-4-[2-(5-methoxyindol-3-ylidene)ethylidene]quinoline;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-4-[2-(5-methoxyindol-3-ylidene)ethylidene]quinoline;hydroiodide?
The IUPAC name of 1-ethyl-4-[2-(5-methoxyindol-3-ylidene)ethylidene]quinoline;hydroiodide (CID 131666989) is 1-ethyl-4-[2-(5-methoxyindol-3-ylidene)ethylidene]quinoline;hydroiodide.
What is the SMILES notation for 1-ethyl-4-[2-(5-methoxyindol-3-ylidene)ethylidene]quinoline;hydroiodide?
The canonical SMILES for 1-ethyl-4-[2-(5-methoxyindol-3-ylidene)ethylidene]quinoline;hydroiodide is CCN1C=CC(=CC=C2C=Nc3ccc(OC)cc32)c2ccccc21.I.
What is the InChIKey of 1-ethyl-4-[2-(5-methoxyindol-3-ylidene)ethylidene]quinoline;hydroiodide?
The InChIKey is BWZODQDJTUVIDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20N2O.HI/c1-3-24-13-12-16(19-6-4-5-7-22(19)24)8-9-17-15-23-21-11-10-18(25-2)14-20(17)21;/h4-15H,3H2,1-2H3;1H.
What are the key properties of 1-ethyl-4-[2-(5-methoxyindol-3-ylidene)ethylidene]quinoline;hydroiodide?
1-ethyl-4-[2-(5-methoxyindol-3-ylidene)ethylidene]quinoline;hydroiodide has a molecular weight of 456.33 g/mol, XLogP of 5.85, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-4-[2-(5-methoxyindol-3-ylidene)ethylidene]quinoline;hydroiodide is sourced from PubChem (CID 131666989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).