C34H29BN2O2 — CID 88617225
2-[[diphenylboranyl(phenyl)methylidene]amino]-4-(1-ethylquinolin-4-ylidene)but-2-enoic acid (PubChem CID 88617225) has the molecular formula C34H29BN2O2 and a molecular weight of 508.43 g/mol. Its IUPAC name is 2-[[diphenylboranyl(phenyl)methylidene]amino]-4-(1-ethylquinolin-4-ylidene)but-2-enoic acid.
| Compound Name | 2-[[diphenylboranyl(phenyl)methylidene]amino]-4-(1-ethylquinolin-4-ylidene)but-2-enoic acid |
|---|---|
| PubChem CID | 88617225 |
| Molecular Formula | C34H29BN2O2 |
| Molecular Weight | 508.43 g/mol |
| Exact Mass | 508.23 |
| IUPAC Name | 2-[[diphenylboranyl(phenyl)methylidene]amino]-4-(1-ethylquinolin-4-ylidene)but-2-enoic acid |
| SMILES | CCN1C=CC(=CC=C(/N=C(/B(c2ccccc2)c2ccccc2)c2ccccc2)C(=O)O)c2ccccc21 |
| InChI | InChI=1S/C34H29BN2O2/c1-2-37-25-24-26(30-20-12-13-21-32(30)37)22-23-31(34(38)39)36-33(27-14-6-3-7-15-27)35(28-16-8-4-9-17-28)29-18-10-5-11-19-29/h3-25H,2H2,1H3,(H,38,39)/b26-22?,31-23?,36-33+ |
| InChIKey | ALJRDHMCGSPUMD-RZRGUMEBSA-N |
| XLogP | 5.73 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.43 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|