C26H25BN2O2 — CID 88632823
5-(dimethylamino)-2-[[diphenylboranyl(phenyl)methylidene]amino]penta-2,4-dienoic acid (PubChem CID 88632823) has the molecular formula C26H25BN2O2 and a molecular weight of 408.31 g/mol. Its IUPAC name is 5-(dimethylamino)-2-[[diphenylboranyl(phenyl)methylidene]amino]penta-2,4-dienoic acid.
| Compound Name | 5-(dimethylamino)-2-[[diphenylboranyl(phenyl)methylidene]amino]penta-2,4-dienoic acid |
|---|---|
| PubChem CID | 88632823 |
| Molecular Formula | C26H25BN2O2 |
| Molecular Weight | 408.31 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | 5-(dimethylamino)-2-[[diphenylboranyl(phenyl)methylidene]amino]penta-2,4-dienoic acid |
| SMILES | CN(C)C=CC=C(/N=C(/B(c1ccccc1)c1ccccc1)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C26H25BN2O2/c1-29(2)20-12-19-24(26(30)31)28-25(21-13-6-3-7-14-21)27(22-15-8-4-9-16-22)23-17-10-5-11-18-23/h3-20H,1-2H3,(H,30,31)/b20-12?,24-19?,28-25+ |
| InChIKey | VULUSTACOGOQKD-ODVFJIEYSA-N |
| XLogP | 3.37 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.31 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|