C17H25N — CID 131668020
N,N-dimethyl-2-[3-(1,1,2,2,3,3,4,4,4-nonadeuteriobutyl)-1H-inden-2-yl]ethanamine (PubChem CID 131668020) has the molecular formula C17H25N and a molecular weight of 252.45 g/mol. Its IUPAC name is N,N-dimethyl-2-[3-(1,1,2,2,3,3,4,4,4-nonadeuteriobutyl)-1H-inden-2-yl]ethanamine.
| Compound Name | N,N-dimethyl-2-[3-(1,1,2,2,3,3,4,4,4-nonadeuteriobutyl)-1H-inden-2-yl]ethanamine |
|---|---|
| PubChem CID | 131668020 |
| Molecular Formula | C17H25N |
| Molecular Weight | 252.45 g/mol |
| Exact Mass | 252.26 |
| IUPAC Name | N,N-dimethyl-2-[3-(1,1,2,2,3,3,4,4,4-nonadeuteriobutyl)-1H-inden-2-yl]ethanamine |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C1=C(CCN(C)C)Cc2ccccc21 |
| InChI | InChI=1S/C17H25N/c1-4-5-9-16-15(11-12-18(2)3)13-14-8-6-7-10-17(14)16/h6-8,10H,4-5,9,11-13H2,1-3H3/i1D3,4D2,5D2,9D2 |
| InChIKey | QRBCJHCPOPCDIE-DWSSIXMBSA-N |
| XLogP | 4.14 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.45 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |