C18H27NO2 — CID 143121056
2-(3-ethyl-1H-inden-2-yl)-N,N-dimethylethanamine;propanoic acid (PubChem CID 143121056) has the molecular formula C18H27NO2 and a molecular weight of 289.42 g/mol. Its IUPAC name is 2-(3-ethyl-1H-inden-2-yl)-N,N-dimethylethanamine;propanoic acid.
| Compound Name | 2-(3-ethyl-1H-inden-2-yl)-N,N-dimethylethanamine;propanoic acid |
|---|---|
| PubChem CID | 143121056 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | 2-(3-ethyl-1H-inden-2-yl)-N,N-dimethylethanamine;propanoic acid |
| SMILES | CCC(=O)O.CCC1=C(CCN(C)C)Cc2ccccc21 |
| InChI | InChI=1S/C15H21N.C3H6O2/c1-4-14-13(9-10-16(2)3)11-12-7-5-6-8-15(12)14;1-2-3(4)5/h5-8H,4,9-11H2,1-3H3;2H2,1H3,(H,4,5) |
| InChIKey | VCWSKMUGVDKFDP-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |