C18H24N4O2S2 — CID 131672821
2-methyl-8-propan-2-yl-5-(thiophen-3-ylmethyl)-9λ6-thia-2,5,8,14-tetrazatricyclo[8.4.0.03,7]tetradeca-1(10),11,13-triene 9,9-dioxide (PubChem CID 131672821) has the molecular formula C18H24N4O2S2 and a molecular weight of 392.55 g/mol. Its IUPAC name is 2-methyl-8-propan-2-yl-5-(thiophen-3-ylmethyl)-9λ6-thia-2,5,8,14-tetrazatricyclo[8.4.0.03,7]tetradeca-1(10),11,13-triene 9,9-dioxide.
| Compound Name | 2-methyl-8-propan-2-yl-5-(thiophen-3-ylmethyl)-9λ6-thia-2,5,8,14-tetrazatricyclo[8.4.0.03,7]tetradeca-1(10),11,13-triene 9,9-dioxide |
|---|---|
| PubChem CID | 131672821 |
| Molecular Formula | C18H24N4O2S2 |
| Molecular Weight | 392.55 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | 2-methyl-8-propan-2-yl-5-(thiophen-3-ylmethyl)-9λ6-thia-2,5,8,14-tetrazatricyclo[8.4.0.03,7]tetradeca-1(10),11,13-triene 9,9-dioxide |
| SMILES | CC(C)N1C2CN(Cc3ccsc3)CC2N(C)c2ncccc2S1(=O)=O |
| InChI | InChI=1S/C18H24N4O2S2/c1-13(2)22-16-11-21(9-14-6-8-25-12-14)10-15(16)20(3)18-17(26(22,23)24)5-4-7-19-18/h4-8,12-13,15-16H,9-11H2,1-3H3 |
| InChIKey | HHXXVKIJQORQOX-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.55 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |