C19H24N6O3 — CID 131673096
12-N-(4-methoxyphenyl)-5-N,5-N-dimethyl-1,5,10,11-tetrazatricyclo[7.3.0.03,7]dodeca-9,11-diene-5,12-dicarboxamide (PubChem CID 131673096) has the molecular formula C19H24N6O3 and a molecular weight of 384.44 g/mol. Its IUPAC name is 12-N-(4-methoxyphenyl)-5-N,5-N-dimethyl-1,5,10,11-tetrazatricyclo[7.3.0.03,7]dodeca-9,11-diene-5,12-dicarboxamide.
| Compound Name | 12-N-(4-methoxyphenyl)-5-N,5-N-dimethyl-1,5,10,11-tetrazatricyclo[7.3.0.03,7]dodeca-9,11-diene-5,12-dicarboxamide |
|---|---|
| PubChem CID | 131673096 |
| Molecular Formula | C19H24N6O3 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | 12-N-(4-methoxyphenyl)-5-N,5-N-dimethyl-1,5,10,11-tetrazatricyclo[7.3.0.03,7]dodeca-9,11-diene-5,12-dicarboxamide |
| SMILES | COc1ccc(NC(=O)c2nnc3n2CC2CN(C(=O)N(C)C)CC2C3)cc1 |
| InChI | InChI=1S/C19H24N6O3/c1-23(2)19(27)24-9-12-8-16-21-22-17(25(16)11-13(12)10-24)18(26)20-14-4-6-15(28-3)7-5-14/h4-7,12-13H,8-11H2,1-3H3,(H,20,26) |
| InChIKey | DLQRUKCOCRYNQI-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 92.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |