C22H27N7O2 — CID 131673091
5-[(1-ethylpyrazol-4-yl)methyl]-N-(4-methoxyphenyl)-1,5,10,11-tetrazatricyclo[7.3.0.03,7]dodeca-9,11-diene-12-carboxamide (PubChem CID 131673091) has the molecular formula C22H27N7O2 and a molecular weight of 421.51 g/mol. Its IUPAC name is 5-[(1-ethylpyrazol-4-yl)methyl]-N-(4-methoxyphenyl)-1,5,10,11-tetrazatricyclo[7.3.0.03,7]dodeca-9,11-diene-12-carboxamide.
| Compound Name | 5-[(1-ethylpyrazol-4-yl)methyl]-N-(4-methoxyphenyl)-1,5,10,11-tetrazatricyclo[7.3.0.03,7]dodeca-9,11-diene-12-carboxamide |
|---|---|
| PubChem CID | 131673091 |
| Molecular Formula | C22H27N7O2 |
| Molecular Weight | 421.51 g/mol |
| Exact Mass | 421.22 |
| IUPAC Name | 5-[(1-ethylpyrazol-4-yl)methyl]-N-(4-methoxyphenyl)-1,5,10,11-tetrazatricyclo[7.3.0.03,7]dodeca-9,11-diene-12-carboxamide |
| SMILES | CCn1cc(CN2CC3Cc4nnc(C(=O)Nc5ccc(OC)cc5)n4CC3C2)cn1 |
| InChI | InChI=1S/C22H27N7O2/c1-3-28-11-15(9-23-28)10-27-12-16-8-20-25-26-21(29(20)14-17(16)13-27)22(30)24-18-4-6-19(31-2)7-5-18/h4-7,9,11,16-17H,3,8,10,12-14H2,1-2H3,(H,24,30) |
| InChIKey | VIOAYHMBZPQWRT-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 90.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.51 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |